C46H45N3O7S — CID 3623460
N-[[3-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyhexanediamide (PubChem CID 3623460) has the molecular formula C46H45N3O7S and a molecular weight of 783.95 g/mol. Its IUPAC name is N-[[3-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyhexanediamide.
| Compound Name | N-[[3-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 3623460 |
| Molecular Formula | C46H45N3O7S |
| Molecular Weight | 783.95 g/mol |
| Exact Mass | 783.30 |
| IUPAC Name | N-[[3-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-hydroxyhexanediamide |
| SMILES | O=C(CCCCC(=O)NCc1cccc(-c2cccc(C3OC(CSc4nc(-c5ccccc5)c(-c5ccccc5)o4)CC(c4ccc(CO)cc4)O3)c2)c1)NO |
| InChI | InChI=1S/C46H45N3O7S/c50-29-31-21-23-33(24-22-31)40-27-39(30-57-46-48-43(34-12-3-1-4-13-34)44(56-46)35-14-5-2-6-15-35)54-45(55-40)38-18-10-17-37(26-38)36-16-9-11-32(25-36)28-47-41(51)19-7-8-20-42(52)49-53/h1-6,9-18,21-26,39-40,45,50,53H,7-8,19-20,27-30H2,(H,47,51)(H,49,52) |
| InChIKey | NRVDMUMTSNUCIM-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 143.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.95 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|