C41H43N3O7S — CID 3626136
N-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyoctanediamide (PubChem CID 3626136) has the molecular formula C41H43N3O7S and a molecular weight of 721.88 g/mol. Its IUPAC name is N-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 3626136 |
| Molecular Formula | C41H43N3O7S |
| Molecular Weight | 721.88 g/mol |
| Exact Mass | 721.28 |
| IUPAC Name | N-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1cccc(C2OC(CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)CC(c3ccc(CO)cc3)O2)c1)NO |
| InChI | InChI=1S/C41H43N3O7S/c45-26-28-20-22-29(23-21-28)35-25-34(27-52-41-43-38(30-12-5-3-6-13-30)39(51-41)31-14-7-4-8-15-31)49-40(50-35)32-16-11-17-33(24-32)42-36(46)18-9-1-2-10-19-37(47)44-48/h3-8,11-17,20-24,34-35,40,45,48H,1-2,9-10,18-19,25-27H2,(H,42,46)(H,44,47) |
| InChIKey | ZRYVPIBIUVYQLC-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 143.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.88 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|