C47H46N2O7S — CID 6675836
7-[[2-[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid (PubChem CID 6675836) has the molecular formula C47H46N2O7S and a molecular weight of 782.96 g/mol. Its IUPAC name is 7-[[2-[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid.
| Compound Name | 7-[[2-[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 6675836 |
| Molecular Formula | C47H46N2O7S |
| Molecular Weight | 782.96 g/mol |
| Exact Mass | 782.30 |
| IUPAC Name | 7-[[2-[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid |
| SMILES | O=C(O)CCCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C47H46N2O7S/c50-30-32-20-22-34(23-21-32)41-28-39(31-57-47-49-44(35-12-4-1-5-13-35)45(56-47)36-14-6-2-7-15-36)54-46(55-41)37-26-24-33(25-27-37)40-17-11-10-16-38(40)29-48-42(51)18-8-3-9-19-43(52)53/h1-2,4-7,10-17,20-27,39,41,46,50H,3,8-9,18-19,28-31H2,(H,48,51)(H,52,53)/t39-,41+,46+/m1/s1 |
| InChIKey | QZAWMRWNQBEJGM-VOSSTTPSSA-N |
| XLogP | 10.16 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.96 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|