C46H44N2O7S — CID 6679445
6-[[3-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid (PubChem CID 6679445) has the molecular formula C46H44N2O7S and a molecular weight of 768.93 g/mol. Its IUPAC name is 6-[[3-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid.
| Compound Name | 6-[[3-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 6679445 |
| Molecular Formula | C46H44N2O7S |
| Molecular Weight | 768.93 g/mol |
| Exact Mass | 768.29 |
| IUPAC Name | 6-[[3-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)NCc1cccc(-c2cccc([C@@H]3O[C@H](CSc4nc(-c5ccccc5)c(-c5ccccc5)o4)C[C@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C46H44N2O7S/c49-29-31-21-23-33(24-22-31)40-27-39(30-56-46-48-43(34-12-3-1-4-13-34)44(55-46)35-14-5-2-6-15-35)53-45(54-40)38-18-10-17-37(26-38)36-16-9-11-32(25-36)28-47-41(50)19-7-8-20-42(51)52/h1-6,9-18,21-26,39-40,45,49H,7-8,19-20,27-30H2,(H,47,50)(H,51,52)/t39-,40+,45+/m0/s1 |
| InChIKey | OWLOUVBKGRXVLQ-XFGDFDOYSA-N |
| XLogP | 9.77 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.93 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|