C42H38N2O5S — CID 6698498
N-[[3-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6698498) has the molecular formula C42H38N2O5S and a molecular weight of 682.84 g/mol. Its IUPAC name is N-[[3-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | N-[[3-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6698498 |
| Molecular Formula | C42H38N2O5S |
| Molecular Weight | 682.84 g/mol |
| Exact Mass | 682.25 |
| IUPAC Name | N-[[3-[3-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cccc(-c2cccc([C@@H]3O[C@H](CSc4nc(-c5ccccc5)c(-c5ccccc5)o4)C[C@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C42H38N2O5S/c1-28(46)43-25-30-10-8-15-34(22-30)35-16-9-17-36(23-35)41-47-37(24-38(48-41)31-20-18-29(26-45)19-21-31)27-50-42-44-39(32-11-4-2-5-12-32)40(49-42)33-13-6-3-7-14-33/h2-23,37-38,41,45H,24-27H2,1H3,(H,43,46)/t37-,38+,41+/m0/s1 |
| InChIKey | GFRLUTVHWTYKND-XELUODRTSA-N |
| XLogP | 9.14 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.84 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |