C34H32N2O4S — CID 6698421
[4-[(2S,4R,6S)-2-[4-(aminomethyl)phenyl]-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6698421) has the molecular formula C34H32N2O4S and a molecular weight of 564.71 g/mol. Its IUPAC name is [4-[(2S,4R,6S)-2-[4-(aminomethyl)phenyl]-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2S,4R,6S)-2-[4-(aminomethyl)phenyl]-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6698421 |
| Molecular Formula | C34H32N2O4S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | [4-[(2S,4R,6S)-2-[4-(aminomethyl)phenyl]-6-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | NCc1ccc([C@@H]2O[C@H](CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C34H32N2O4S/c35-20-23-11-17-28(18-12-23)33-38-29(19-30(39-33)25-15-13-24(21-37)14-16-25)22-41-34-36-31(26-7-3-1-4-8-26)32(40-34)27-9-5-2-6-10-27/h1-18,29-30,33,37H,19-22,35H2/t29-,30+,33+/m0/s1 |
| InChIKey | LHHFSQJSPYQFHV-AARCXHMLSA-N |
| XLogP | 7.30 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |