C36H31Cl3N2O5S — CID 6703920
2,2,2-trichloro-N-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide (PubChem CID 6703920) has the molecular formula C36H31Cl3N2O5S and a molecular weight of 710.08 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6703920 |
| Molecular Formula | C36H31Cl3N2O5S |
| Molecular Weight | 710.08 g/mol |
| Exact Mass | 708.10 |
| IUPAC Name | 2,2,2-trichloro-N-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
| SMILES | O=C(NCc1ccc([C@H]2O[C@@H](CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)C[C@@H](c3ccc(CO)cc3)O2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C36H31Cl3N2O5S/c37-36(38,39)34(43)40-20-23-11-17-28(18-12-23)33-44-29(19-30(45-33)25-15-13-24(21-42)14-16-25)22-47-35-41-31(26-7-3-1-4-8-26)32(46-35)27-9-5-2-6-10-27/h1-18,29-30,33,42H,19-22H2,(H,40,43)/t29-,30+,33+/m1/s1 |
| InChIKey | MIAFBSOHBPDFIN-ROCBYOHGSA-N |
| XLogP | 8.82 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.08 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|