C47H35F5N2O5S — CID 3517021
N-[[3-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 3517021) has the molecular formula C47H35F5N2O5S and a molecular weight of 834.86 g/mol. Its IUPAC name is N-[[3-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[[3-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 3517021 |
| Molecular Formula | C47H35F5N2O5S |
| Molecular Weight | 834.86 g/mol |
| Exact Mass | 834.22 |
| IUPAC Name | N-[[3-[3-[4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(NCc1cccc(-c2cccc(C3OC(CSc4nc(-c5ccccc5)c(-c5ccccc5)o4)CC(c4ccc(CO)cc4)O3)c2)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C47H35F5N2O5S/c48-38-37(39(49)41(51)42(52)40(38)50)45(56)53-24-28-9-7-14-32(21-28)33-15-8-16-34(22-33)46-57-35(23-36(58-46)29-19-17-27(25-55)18-20-29)26-60-47-54-43(30-10-3-1-4-11-30)44(59-47)31-12-5-2-6-13-31/h1-22,35-36,46,55H,23-26H2,(H,53,56) |
| InChIKey | ZPCUJYRJIRGHPK-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.86 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|