C35H29Cl3N2O5S — CID 6703898
2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6703898) has the molecular formula C35H29Cl3N2O5S and a molecular weight of 696.05 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6703898 |
| Molecular Formula | C35H29Cl3N2O5S |
| Molecular Weight | 696.05 g/mol |
| Exact Mass | 694.09 |
| IUPAC Name | 2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | O=C(Nc1cccc([C@H]2O[C@@H](CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)C[C@@H](c3ccc(CO)cc3)O2)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C35H29Cl3N2O5S/c36-35(37,38)33(42)39-27-13-7-12-26(18-27)32-43-28(19-29(44-32)23-16-14-22(20-41)15-17-23)21-46-34-40-30(24-8-3-1-4-9-24)31(45-34)25-10-5-2-6-11-25/h1-18,28-29,32,41H,19-21H2,(H,39,42)/t28-,29+,32+/m1/s1 |
| InChIKey | AFRQMGIPRKAFJP-PRMIEGHPSA-N |
| XLogP | 9.15 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.05 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|