C28H27Cl3N2O5S — CID 6702248
N-[3-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide (PubChem CID 6702248) has the molecular formula C28H27Cl3N2O5S and a molecular weight of 609.96 g/mol. Its IUPAC name is N-[3-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[3-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 6702248 |
| Molecular Formula | C28H27Cl3N2O5S |
| Molecular Weight | 609.96 g/mol |
| Exact Mass | 608.07 |
| IUPAC Name | N-[3-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide |
| SMILES | CC(=O)Nc1ccc(SC[C@H]2C[C@@H](c3ccc(CO)cc3)O[C@@H](c3cccc(NC(=O)C(Cl)(Cl)Cl)c3)O2)cc1 |
| InChI | InChI=1S/C28H27Cl3N2O5S/c1-17(35)32-21-9-11-24(12-10-21)39-16-23-14-25(19-7-5-18(15-34)6-8-19)38-26(37-23)20-3-2-4-22(13-20)33-27(36)28(29,30)31/h2-13,23,25-26,34H,14-16H2,1H3,(H,32,35)(H,33,36)/t23-,25+,26+/m1/s1 |
| InChIKey | DJOPTLHPFLQLGQ-AFESJLNVSA-N |
| XLogP | 6.78 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.96 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|