C33H34F3N3O6S — CID 6702253
(2S)-N-[3-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6702253) has the molecular formula C33H34F3N3O6S and a molecular weight of 657.71 g/mol. Its IUPAC name is (2S)-N-[3-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6702253 |
| Molecular Formula | C33H34F3N3O6S |
| Molecular Weight | 657.71 g/mol |
| Exact Mass | 657.21 |
| IUPAC Name | (2S)-N-[3-[(2R,4R,6S)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(SC[C@H]2C[C@@H](c3ccc(CO)cc3)O[C@@H](c3cccc(NC(=O)[C@@H]4CCCN4C(=O)C(F)(F)F)c3)O2)cc1 |
| InChI | InChI=1S/C33H34F3N3O6S/c1-20(41)37-24-11-13-27(14-12-24)46-19-26-17-29(22-9-7-21(18-40)8-10-22)45-31(44-26)23-4-2-5-25(16-23)38-30(42)28-6-3-15-39(28)32(43)33(34,35)36/h2,4-5,7-14,16,26,28-29,31,40H,3,6,15,17-19H2,1H3,(H,37,41)(H,38,42)/t26-,28+,29+,31+/m1/s1 |
| InChIKey | ZQYABELFLAVEJF-RNWXARPHSA-N |
| XLogP | 5.97 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.71 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |