C27H28F3N5O5S — CID 6707367
(2S)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6707367) has the molecular formula C27H28F3N5O5S and a molecular weight of 591.61 g/mol. Its IUPAC name is (2S)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6707367 |
| Molecular Formula | C27H28F3N5O5S |
| Molecular Weight | 591.61 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | (2S)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc([C@H]2O[C@@H](CSc3ncn[nH]3)C[C@@H](c3ccc(CO)cc3)O2)cc1)[C@@H]1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C27H28F3N5O5S/c28-27(29,30)25(38)35-11-1-2-21(35)23(37)33-19-9-7-18(8-10-19)24-39-20(14-41-26-31-15-32-34-26)12-22(40-24)17-5-3-16(13-36)4-6-17/h3-10,15,20-22,24,36H,1-2,11-14H2,(H,33,37)(H,31,32,34)/t20-,21+,22+,24+/m1/s1 |
| InChIKey | ILHYWUUSBLBWHM-VCHRRKICSA-N |
| XLogP | 4.13 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |