C28H30F3N5O5S — CID 4616754
N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 4616754) has the molecular formula C28H30F3N5O5S and a molecular weight of 605.64 g/mol. Its IUPAC name is N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 4616754 |
| Molecular Formula | C28H30F3N5O5S |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | N-[3-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | CC1C(CSc2ncn[nH]2)OC(c2cccc(NC(=O)C3CCCN3C(=O)C(F)(F)F)c2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C28H30F3N5O5S/c1-16-22(14-42-27-32-15-33-35-27)40-25(41-23(16)18-9-7-17(13-37)8-10-18)19-4-2-5-20(12-19)34-24(38)21-6-3-11-36(21)26(39)28(29,30)31/h2,4-5,7-10,12,15-16,21-23,25,37H,3,6,11,13-14H2,1H3,(H,34,38)(H,32,33,35) |
| InChIKey | ZRUVTWGZXRXKJV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |