C28H33F3N2O6S — CID 6687389
(2S)-N-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6687389) has the molecular formula C28H33F3N2O6S and a molecular weight of 582.64 g/mol. Its IUPAC name is (2S)-N-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6687389 |
| Molecular Formula | C28H33F3N2O6S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | (2S)-N-[3-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)[C@@H]3CCCN3C(=O)C(F)(F)F)c2)O[C@H]1CSCCO |
| InChI | InChI=1S/C28H33F3N2O6S/c1-17-23(16-40-13-12-34)38-26(39-24(17)19-9-7-18(15-35)8-10-19)20-4-2-5-21(14-20)32-25(36)22-6-3-11-33(22)27(37)28(29,30)31/h2,4-5,7-10,14,17,22-24,26,34-35H,3,6,11-13,15-16H2,1H3,(H,32,36)/t17-,22+,23+,24?,26+/m1/s1 |
| InChIKey | APBIXLXCKJUZAQ-KEHRGRRZSA-N |
| XLogP | 4.19 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|