C30H36F3N3O5 — CID 6681530
(2S)-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6681530) has the molecular formula C30H36F3N3O5 and a molecular weight of 575.63 g/mol. Its IUPAC name is (2S)-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6681530 |
| Molecular Formula | C30H36F3N3O5 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | (2S)-N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | C=CCN(C)C[C@H]1O[C@@H](c2cccc(NC(=O)[C@@H]3CCCN3C(=O)C(F)(F)F)c2)OC(c2ccc(CO)cc2)[C@H]1C |
| InChI | InChI=1S/C30H36F3N3O5/c1-4-14-35(3)17-25-19(2)26(21-12-10-20(18-37)11-13-21)41-28(40-25)22-7-5-8-23(16-22)34-27(38)24-9-6-15-36(24)29(39)30(31,32)33/h4-5,7-8,10-13,16,19,24-26,28,37H,1,6,9,14-15,17-18H2,2-3H3,(H,34,38)/t19-,24-,25+,26?,28+/m0/s1 |
| InChIKey | RSQVYOCGKQZQMR-DYCHHOTASA-N |
| XLogP | 4.58 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|