C32H40F3N3O5 — CID 6707472
(2S)-N-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6707472) has the molecular formula C32H40F3N3O5 and a molecular weight of 603.68 g/mol. Its IUPAC name is (2S)-N-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6707472 |
| Molecular Formula | C32H40F3N3O5 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | (2S)-N-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc([C@H]2O[C@@H](CN3CCCCCCC3)C[C@@H](c3ccc(CO)cc3)O2)cc1)[C@@H]1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C32H40F3N3O5/c33-32(34,35)31(41)38-18-6-7-27(38)29(40)36-25-14-12-24(13-15-25)30-42-26(20-37-16-4-2-1-3-5-17-37)19-28(43-30)23-10-8-22(21-39)9-11-23/h8-15,26-28,30,39H,1-7,16-21H2,(H,36,40)/t26-,27+,28+,30+/m1/s1 |
| InChIKey | PEJMVFQJDMAEME-KGVZJERPSA-N |
| XLogP | 5.48 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |