C39H46F3N3O5 — CID 6699660
(2S)-N-[[3-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6699660) has the molecular formula C39H46F3N3O5 and a molecular weight of 693.81 g/mol. Its IUPAC name is (2S)-N-[[3-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[3-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6699660 |
| Molecular Formula | C39H46F3N3O5 |
| Molecular Weight | 693.81 g/mol |
| Exact Mass | 693.34 |
| IUPAC Name | (2S)-N-[[3-[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1cccc(-c2ccc([C@H]3O[C@@H](CN4CCCCCCC4)C[C@@H](c4ccc(CO)cc4)O3)cc2)c1)[C@@H]1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C39H46F3N3O5/c40-39(41,42)38(48)45-21-7-10-34(45)36(47)43-24-28-8-6-9-32(22-28)29-15-17-31(18-16-29)37-49-33(25-44-19-4-2-1-3-5-20-44)23-35(50-37)30-13-11-27(26-46)12-14-30/h6,8-9,11-18,22,33-35,37,46H,1-5,7,10,19-21,23-26H2,(H,43,47)/t33-,34+,35+,37+/m1/s1 |
| InChIKey | SYXGJKHYESBNGO-MEVGNSNYSA-N |
| XLogP | 6.83 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.81 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |