C28H29F3N4O5S2 — CID 4085719
N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 4085719) has the molecular formula C28H29F3N4O5S2 and a molecular weight of 622.69 g/mol. Its IUPAC name is N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 4085719 |
| Molecular Formula | C28H29F3N4O5S2 |
| Molecular Weight | 622.69 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | Cc1nnc(SCC2CC(c3ccc(CO)cc3)OC(c3cccc(NC(=O)C4CCCN4C(=O)C(F)(F)F)c3)O2)s1 |
| InChI | InChI=1S/C28H29F3N4O5S2/c1-16-33-34-27(42-16)41-15-21-13-23(18-9-7-17(14-36)8-10-18)40-25(39-21)19-4-2-5-20(12-19)32-24(37)22-6-3-11-35(22)26(38)28(29,30)31/h2,4-5,7-10,12,21-23,25,36H,3,6,11,13-15H2,1H3,(H,32,37) |
| InChIKey | NZKGXVQGCVHYQG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.69 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |