C33H36F3N3O5 — CID 6694780
(2S)-N-[3-[(2S,4S,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6694780) has the molecular formula C33H36F3N3O5 and a molecular weight of 611.66 g/mol. Its IUPAC name is (2S)-N-[3-[(2S,4S,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-[(2S,4S,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6694780 |
| Molecular Formula | C33H36F3N3O5 |
| Molecular Weight | 611.66 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | (2S)-N-[3-[(2S,4S,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | CN(Cc1ccccc1)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)[C@@H]3CCCN3C(=O)C(F)(F)F)c2)O1 |
| InChI | InChI=1S/C33H36F3N3O5/c1-38(19-22-7-3-2-4-8-22)20-27-18-29(24-14-12-23(21-40)13-15-24)44-31(43-27)25-9-5-10-26(17-25)37-30(41)28-11-6-16-39(28)32(42)33(34,35)36/h2-5,7-10,12-15,17,27-29,31,40H,6,11,16,18-21H2,1H3,(H,37,41)/t27-,28-,29+,31+/m0/s1 |
| InChIKey | YPJDJNSFZKSVOY-SPCXWRMWSA-N |
| XLogP | 5.35 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.66 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |