C23H22Cl3N3O4S2 — CID 6695104
2,2,2-trichloro-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6695104) has the molecular formula C23H22Cl3N3O4S2 and a molecular weight of 574.94 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6695104 |
| Molecular Formula | C23H22Cl3N3O4S2 |
| Molecular Weight | 574.94 g/mol |
| Exact Mass | 573.01 |
| IUPAC Name | 2,2,2-trichloro-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | Cc1nnc(SC[C@@H]2C[C@H](c3ccc(CO)cc3)O[C@H](c3cccc(NC(=O)C(Cl)(Cl)Cl)c3)O2)s1 |
| InChI | InChI=1S/C23H22Cl3N3O4S2/c1-13-28-29-22(35-13)34-12-18-10-19(15-7-5-14(11-30)6-8-15)33-20(32-18)16-3-2-4-17(9-16)27-21(31)23(24,25)26/h2-9,18-20,30H,10-12H2,1H3,(H,27,31)/t18-,19+,20+/m0/s1 |
| InChIKey | OWDKMCWUWLTPFJ-XUVXKRRUSA-N |
| XLogP | 5.99 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.94 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|