C30H28Cl3N3O4S2 — CID 6700686
2,2,2-trichloro-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6700686) has the molecular formula C30H28Cl3N3O4S2 and a molecular weight of 665.06 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6700686 |
| Molecular Formula | C30H28Cl3N3O4S2 |
| Molecular Weight | 665.06 g/mol |
| Exact Mass | 663.06 |
| IUPAC Name | 2,2,2-trichloro-N-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | Cc1nnc(SC[C@H]2C[C@@H](c3ccc(CO)cc3)O[C@@H](c3cccc(-c4cccc(CNC(=O)C(Cl)(Cl)Cl)c4)c3)O2)s1 |
| InChI | InChI=1S/C30H28Cl3N3O4S2/c1-18-35-36-29(42-18)41-17-25-14-26(21-10-8-19(16-37)9-11-21)40-27(39-25)24-7-3-6-23(13-24)22-5-2-4-20(12-22)15-34-28(38)30(31,32)33/h2-13,25-27,37H,14-17H2,1H3,(H,34,38)/t25-,26+,27+/m1/s1 |
| InChIKey | SUXRIPFZUOULKZ-PVHODMMVSA-N |
| XLogP | 7.33 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.06 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|