C33H29Cl3N2O6S — CID 6701786
2-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[3-[3-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 6701786) has the molecular formula C33H29Cl3N2O6S and a molecular weight of 688.03 g/mol. Its IUPAC name is 2-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[3-[3-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[3-[3-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 6701786 |
| Molecular Formula | C33H29Cl3N2O6S |
| Molecular Weight | 688.03 g/mol |
| Exact Mass | 686.08 |
| IUPAC Name | 2-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[3-[3-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SC[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)C(Cl)(Cl)Cl)c3)c2)O1 |
| InChI | InChI=1S/C33H29Cl3N2O6S/c34-33(35,36)32(42)38-17-21-4-1-5-23(14-21)24-6-2-7-25(15-24)31-43-26(19-45-29-27(30(40)41)8-3-13-37-29)16-28(44-31)22-11-9-20(18-39)10-12-22/h1-15,26,28,31,39H,16-19H2,(H,38,42)(H,40,41)/t26-,28+,31+/m1/s1 |
| InChIKey | IYVGWLZBOTVKAE-RDLJJFNOSA-N |
| XLogP | 7.26 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.03 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|