C34H31Cl3N2O6S — CID 6684947
2-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[3-[3-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 6684947) has the molecular formula C34H31Cl3N2O6S and a molecular weight of 702.06 g/mol. Its IUPAC name is 2-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[3-[3-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[3-[3-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 6684947 |
| Molecular Formula | C34H31Cl3N2O6S |
| Molecular Weight | 702.06 g/mol |
| Exact Mass | 700.10 |
| IUPAC Name | 2-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[3-[3-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2cccc(-c3cccc(CNC(=O)C(Cl)(Cl)Cl)c3)c2)O[C@@H]1CSc1ncccc1C(=O)O |
| InChI | InChI=1S/C34H31Cl3N2O6S/c1-20-28(19-46-30-27(31(41)42)9-4-14-38-30)44-32(45-29(20)23-12-10-21(18-40)11-13-23)26-8-3-7-25(16-26)24-6-2-5-22(15-24)17-39-33(43)34(35,36)37/h2-16,20,28-29,32,40H,17-19H2,1H3,(H,39,43)(H,41,42)/t20-,28+,29?,32+/m0/s1 |
| InChIKey | XJWJLBYQJLSBRJ-IWKXQLNISA-N |
| XLogP | 7.51 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.06 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|