C39H44N4O4S2 — CID 6700704
1-(1-adamantyl)-3-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6700704) has the molecular formula C39H44N4O4S2 and a molecular weight of 696.94 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6700704 |
| Molecular Formula | C39H44N4O4S2 |
| Molecular Weight | 696.94 g/mol |
| Exact Mass | 696.28 |
| IUPAC Name | 1-(1-adamantyl)-3-[[3-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | Cc1nnc(SC[C@H]2C[C@@H](c3ccc(CO)cc3)O[C@@H](c3cccc(-c4cccc(CNC(=O)NC56CC7CC(CC(C7)C5)C6)c4)c3)O2)s1 |
| InChI | InChI=1S/C39H44N4O4S2/c1-24-42-43-38(49-24)48-23-34-17-35(30-10-8-25(22-44)9-11-30)47-36(46-34)33-7-3-6-32(16-33)31-5-2-4-26(15-31)21-40-37(45)41-39-18-27-12-28(19-39)14-29(13-27)20-39/h2-11,15-16,27-29,34-36,44H,12-14,17-23H2,1H3,(H2,40,41,45)/t27?,28?,29?,34-,35+,36+,39?/m1/s1 |
| InChIKey | QNUOVHCTQGCPEN-UMEZBHRLSA-N |
| XLogP | 8.11 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.94 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |