C44H41N3O7S — CID 6708301
methyl (2S)-2-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate (PubChem CID 6708301) has the molecular formula C44H41N3O7S and a molecular weight of 755.89 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6708301 |
| Molecular Formula | C44H41N3O7S |
| Molecular Weight | 755.89 g/mol |
| Exact Mass | 755.27 |
| IUPAC Name | methyl (2S)-2-[[4-[(2R,4R,6S)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)Nc1ccc([C@H]2O[C@@H](CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C44H41N3O7S/c1-51-41(49)37(25-29-11-5-2-6-12-29)46-43(50)45-35-23-21-34(22-24-35)42-52-36(26-38(53-42)31-19-17-30(27-48)18-20-31)28-55-44-47-39(32-13-7-3-8-14-32)40(54-44)33-15-9-4-10-16-33/h2-24,36-38,42,48H,25-28H2,1H3,(H2,45,46,50)/t36-,37+,38+,42+/m1/s1 |
| InChIKey | OMKMSHHIEXUKFG-DODHXRRRSA-N |
| XLogP | 8.74 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.89 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |