C38H36N2O7S — CID 6707238
[(2S)-1-[4-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate (PubChem CID 6707238) has the molecular formula C38H36N2O7S and a molecular weight of 664.78 g/mol. Its IUPAC name is [(2S)-1-[4-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate.
| Compound Name | [(2S)-1-[4-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 6707238 |
| Molecular Formula | C38H36N2O7S |
| Molecular Weight | 664.78 g/mol |
| Exact Mass | 664.22 |
| IUPAC Name | [(2S)-1-[4-[(2S,4S,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)C(=O)Nc1ccc([C@@H]2O[C@H](CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C38H36N2O7S/c1-24(44-25(2)42)36(43)39-31-19-17-30(18-20-31)37-45-32(21-33(46-37)27-15-13-26(22-41)14-16-27)23-48-38-40-34(28-9-5-3-6-10-28)35(47-38)29-11-7-4-8-12-29/h3-20,24,32-33,37,41H,21-23H2,1-2H3,(H,39,43)/t24-,32-,33+,37+/m0/s1 |
| InChIKey | BSXUEGZXCWWGRP-OPZNGSPZSA-N |
| XLogP | 7.73 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.78 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |