C39H38N2O7S — CID 6687156
[(2S)-1-[3-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate (PubChem CID 6687156) has the molecular formula C39H38N2O7S and a molecular weight of 678.81 g/mol. Its IUPAC name is [(2S)-1-[3-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate.
| Compound Name | [(2S)-1-[3-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 6687156 |
| Molecular Formula | C39H38N2O7S |
| Molecular Weight | 678.81 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | [(2S)-1-[3-[(2S,4S,5R,6R)-4-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)C(=O)Nc1cccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)O2)c1 |
| InChI | InChI=1S/C39H38N2O7S/c1-24-33(23-49-39-41-34(28-11-6-4-7-12-28)36(48-39)29-13-8-5-9-14-29)46-38(47-35(24)30-19-17-27(22-42)18-20-30)31-15-10-16-32(21-31)40-37(44)25(2)45-26(3)43/h4-21,24-25,33,35,38,42H,22-23H2,1-3H3,(H,40,44)/t24-,25-,33+,35?,38+/m0/s1 |
| InChIKey | AELKIVMOTFQYFQ-FCPMDYJLSA-N |
| XLogP | 7.97 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.81 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |