C28H35N5O6S — CID 6672624
N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 6672624) has the molecular formula C28H35N5O6S and a molecular weight of 569.68 g/mol. Its IUPAC name is N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 6672624 |
| Molecular Formula | C28H35N5O6S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1cccc([C@H]2O[C@@H](CSc3ncn[nH]3)C[C@@H](c3ccc(CO)cc3)O2)c1)NO |
| InChI | InChI=1S/C28H35N5O6S/c34-16-19-10-12-20(13-11-19)24-15-23(17-40-28-29-18-30-32-28)38-27(39-24)21-6-5-7-22(14-21)31-25(35)8-3-1-2-4-9-26(36)33-37/h5-7,10-14,18,23-24,27,34,37H,1-4,8-9,15-17H2,(H,31,35)(H,33,36)(H,29,30,32)/t23-,24+,27+/m1/s1 |
| InChIKey | SYGHXUWQFCREFM-DXBVXKBHSA-N |
| XLogP | 4.42 |
| TPSA | 158.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|