C34H40N6O5S — CID 6672637
N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 6672637) has the molecular formula C34H40N6O5S and a molecular weight of 644.80 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 6672637 |
| Molecular Formula | C34H40N6O5S |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)Nc1ccc([C@H]2O[C@@H](CSc3ncn[nH]3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C34H40N6O5S/c35-28-7-5-6-8-29(28)39-32(43)10-4-2-1-3-9-31(42)38-26-17-15-25(16-18-26)33-44-27(21-46-34-36-22-37-40-34)19-30(45-33)24-13-11-23(20-41)12-14-24/h5-8,11-18,22,27,30,33,41H,1-4,9-10,19-21,35H2,(H,38,42)(H,39,43)(H,36,37,40)/t27-,30+,33+/m1/s1 |
| InChIKey | JGGSOHZDCHWLAY-DPJKJRSDSA-N |
| XLogP | 6.13 |
| TPSA | 164.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.80 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|