C31H34N6O5S — CID 6672628
N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]pentanediamide (PubChem CID 6672628) has the molecular formula C31H34N6O5S and a molecular weight of 602.72 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]pentanediamide |
|---|---|
| PubChem CID | 6672628 |
| Molecular Formula | C31H34N6O5S |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]pentanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCC(=O)Nc1ccc([C@H]2O[C@@H](CSc3ncn[nH]3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C31H34N6O5S/c32-25-4-1-2-5-26(25)36-29(40)7-3-6-28(39)35-23-14-12-22(13-15-23)30-41-24(18-43-31-33-19-34-37-31)16-27(42-30)21-10-8-20(17-38)9-11-21/h1-2,4-5,8-15,19,24,27,30,38H,3,6-7,16-18,32H2,(H,35,39)(H,36,40)(H,33,34,37)/t24-,27+,30+/m1/s1 |
| InChIKey | SQYXKRMAMVBLEX-XWJWOQKWSA-N |
| XLogP | 4.96 |
| TPSA | 164.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|