C38H41N3O7S — CID 6674290
4-[[(2R,4R,6S)-2-[4-[[7-(2-aminoanilino)-7-oxoheptanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6674290) has the molecular formula C38H41N3O7S and a molecular weight of 683.83 g/mol. Its IUPAC name is 4-[[(2R,4R,6S)-2-[4-[[7-(2-aminoanilino)-7-oxoheptanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2R,4R,6S)-2-[4-[[7-(2-aminoanilino)-7-oxoheptanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6674290 |
| Molecular Formula | C38H41N3O7S |
| Molecular Weight | 683.83 g/mol |
| Exact Mass | 683.27 |
| IUPAC Name | 4-[[(2R,4R,6S)-2-[4-[[7-(2-aminoanilino)-7-oxoheptanoyl]amino]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)Nc1ccc([C@H]2O[C@@H](CSc3ccc(C(=O)O)cc3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C38H41N3O7S/c39-32-6-4-5-7-33(32)41-36(44)9-3-1-2-8-35(43)40-29-18-14-28(15-19-29)38-47-30(24-49-31-20-16-27(17-21-31)37(45)46)22-34(48-38)26-12-10-25(23-42)11-13-26/h4-7,10-21,30,34,38,42H,1-3,8-9,22-24,39H2,(H,40,43)(H,41,44)(H,45,46)/t30-,34+,38+/m1/s1 |
| InChIKey | YTKZVNHTWJQEEN-XFQGWCQUSA-N |
| XLogP | 7.32 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.83 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|