C45H47N3O7S — CID 6674326
4-[[(2R,4R,6S)-2-[4-[2-[[[7-(2-aminoanilino)-7-oxoheptanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6674326) has the molecular formula C45H47N3O7S and a molecular weight of 773.95 g/mol. Its IUPAC name is 4-[[(2R,4R,6S)-2-[4-[2-[[[7-(2-aminoanilino)-7-oxoheptanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2R,4R,6S)-2-[4-[2-[[[7-(2-aminoanilino)-7-oxoheptanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6674326 |
| Molecular Formula | C45H47N3O7S |
| Molecular Weight | 773.95 g/mol |
| Exact Mass | 773.31 |
| IUPAC Name | 4-[[(2R,4R,6S)-2-[4-[2-[[[7-(2-aminoanilino)-7-oxoheptanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CSc3ccc(C(=O)O)cc3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C45H47N3O7S/c46-39-10-6-7-11-40(39)48-43(51)13-3-1-2-12-42(50)47-27-35-8-4-5-9-38(35)31-18-20-34(21-19-31)45-54-36(29-56-37-24-22-33(23-25-37)44(52)53)26-41(55-45)32-16-14-30(28-49)15-17-32/h4-11,14-25,36,41,45,49H,1-3,12-13,26-29,46H2,(H,47,50)(H,48,51)(H,52,53)/t36-,41+,45+/m1/s1 |
| InChIKey | WWXZJJUNQNZUQA-NMQJZIIFSA-N |
| XLogP | 8.67 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.95 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|