C46H51N3O6S — CID 3670118
N'-(2-aminophenyl)-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide (PubChem CID 3670118) has the molecular formula C46H51N3O6S and a molecular weight of 774.00 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 3670118 |
| Molecular Formula | C46H51N3O6S |
| Molecular Weight | 774.00 g/mol |
| Exact Mass | 773.35 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]octanediamide |
| SMILES | COc1ccccc1SCC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3ccccc3CNC(=O)CCCCCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C46H51N3O6S/c1-53-41-16-10-11-17-43(41)56-31-37-28-42(34-22-20-32(30-50)21-23-34)55-46(54-37)35-26-24-33(25-27-35)38-13-7-6-12-36(38)29-48-44(51)18-4-2-3-5-19-45(52)49-40-15-9-8-14-39(40)47/h6-17,20-27,37,42,46,50H,2-5,18-19,28-31,47H2,1H3,(H,48,51)(H,49,52) |
| InChIKey | KIDVKTQAOLZDOH-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.00 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|