C45H49N3O6S — CID 3996282
N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 3996282) has the molecular formula C45H49N3O6S and a molecular weight of 759.97 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 3996282 |
| Molecular Formula | C45H49N3O6S |
| Molecular Weight | 759.97 g/mol |
| Exact Mass | 759.33 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | COc1ccccc1SCC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3cccc(CNC(=O)CCCCCC(=O)Nc4ccccc4N)c3)cc2)O1 |
| InChI | InChI=1S/C45H49N3O6S/c1-52-40-14-7-8-15-42(40)55-30-37-27-41(34-20-18-31(29-49)19-21-34)54-45(53-37)35-24-22-33(23-25-35)36-11-9-10-32(26-36)28-47-43(50)16-3-2-4-17-44(51)48-39-13-6-5-12-38(39)46/h5-15,18-26,37,41,45,49H,2-4,16-17,27-30,46H2,1H3,(H,47,50)(H,48,51) |
| InChIKey | MYCMHIUGCBCIND-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.97 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|