C46H49N3O7S — CID 3521649
2-[[2-[4-[3-[[[8-(2-aminoanilino)-8-oxooctanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 3521649) has the molecular formula C46H49N3O7S and a molecular weight of 787.98 g/mol. Its IUPAC name is 2-[[2-[4-[3-[[[8-(2-aminoanilino)-8-oxooctanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[2-[4-[3-[[[8-(2-aminoanilino)-8-oxooctanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 3521649 |
| Molecular Formula | C46H49N3O7S |
| Molecular Weight | 787.98 g/mol |
| Exact Mass | 787.33 |
| IUPAC Name | 2-[[2-[4-[3-[[[8-(2-aminoanilino)-8-oxooctanoyl]amino]methyl]phenyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)NCc1cccc(-c2ccc(C3OC(CSc4ccccc4C(=O)O)CC(c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C46H49N3O7S/c47-39-13-6-7-14-40(39)49-44(52)17-4-2-1-3-16-43(51)48-28-32-10-9-11-36(26-32)33-22-24-35(25-23-33)46-55-37(30-57-42-15-8-5-12-38(42)45(53)54)27-41(56-46)34-20-18-31(29-50)19-21-34/h5-15,18-26,37,41,46,50H,1-4,16-17,27-30,47H2,(H,48,51)(H,49,52)(H,53,54) |
| InChIKey | BYYPJEOAGYFHQF-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.98 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|