C40H47N3O6S — CID 3569787
N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide (PubChem CID 3569787) has the molecular formula C40H47N3O6S and a molecular weight of 697.90 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 3569787 |
| Molecular Formula | C40H47N3O6S |
| Molecular Weight | 697.90 g/mol |
| Exact Mass | 697.32 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
| SMILES | COc1ccccc1SCC1CC(c2ccc(CO)cc2)OC(c2ccc(CNC(=O)CCCCCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C40H47N3O6S/c1-47-35-12-8-9-13-37(35)50-27-32-24-36(30-20-18-29(26-44)19-21-30)49-40(48-32)31-22-16-28(17-23-31)25-42-38(45)14-4-2-3-5-15-39(46)43-34-11-7-6-10-33(34)41/h6-13,16-23,32,36,40,44H,2-5,14-15,24-27,41H2,1H3,(H,42,45)(H,43,46) |
| InChIKey | HUOOOIJAABROGO-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.90 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|