C33H40N2O7S — CID 6677541
N'-hydroxy-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide (PubChem CID 6677541) has the molecular formula C33H40N2O7S and a molecular weight of 608.76 g/mol. Its IUPAC name is N'-hydroxy-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6677541 |
| Molecular Formula | C33H40N2O7S |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | N'-hydroxy-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
| SMILES | COc1ccccc1SC[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(CNC(=O)CCCCCC(=O)NO)cc2)O1 |
| InChI | InChI=1S/C33H40N2O7S/c1-40-28-7-5-6-8-30(28)43-22-27-19-29(25-15-13-24(21-36)14-16-25)42-33(41-27)26-17-11-23(12-18-26)20-34-31(37)9-3-2-4-10-32(38)35-39/h5-8,11-18,27,29,33,36,39H,2-4,9-10,19-22H2,1H3,(H,34,37)(H,35,38)/t27-,29+,33+/m0/s1 |
| InChIKey | POCKWZLEEIWLII-WHPNFGMDSA-N |
| XLogP | 5.60 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|