C37H42N4O5S — CID 6672862
N'-(2-aminophenyl)-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide (PubChem CID 6672862) has the molecular formula C37H42N4O5S and a molecular weight of 654.83 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6672862 |
| Molecular Formula | C37H42N4O5S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.29 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)NCc1ccc([C@H]2O[C@@H](CSc3ccccn3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C37H42N4O5S/c38-31-8-4-5-9-32(31)41-35(44)11-3-1-2-10-34(43)40-23-26-13-19-29(20-14-26)37-45-30(25-47-36-12-6-7-21-39-36)22-33(46-37)28-17-15-27(24-42)16-18-28/h4-9,12-21,30,33,37,42H,1-3,10-11,22-25,38H2,(H,40,43)(H,41,44)/t30-,33+,37+/m1/s1 |
| InChIKey | JANBKAWDBZUIIR-NPUNRRGQSA-N |
| XLogP | 6.70 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|