C37H41N3O5S — CID 6676387
N'-(2-aminophenyl)-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide (PubChem CID 6676387) has the molecular formula C37H41N3O5S and a molecular weight of 639.82 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 6676387 |
| Molecular Formula | C37H41N3O5S |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)NCc1ccc([C@@H]2O[C@H](CSc3ccccc3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C37H41N3O5S/c38-32-10-4-5-11-33(32)40-36(43)13-7-6-12-35(42)39-23-26-14-20-29(21-15-26)37-44-30(25-46-31-8-2-1-3-9-31)22-34(45-37)28-18-16-27(24-41)17-19-28/h1-5,8-11,14-21,30,34,37,41H,6-7,12-13,22-25,38H2,(H,39,42)(H,40,43)/t30-,34+,37+/m0/s1 |
| InChIKey | SIESVJAYEUTCSY-XSFZZWOTSA-N |
| XLogP | 6.91 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|