C43H45N3O5S — CID 6672811
N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide (PubChem CID 6672811) has the molecular formula C43H45N3O5S and a molecular weight of 715.92 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 6672811 |
| Molecular Formula | C43H45N3O5S |
| Molecular Weight | 715.92 g/mol |
| Exact Mass | 715.31 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(phenylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CSc3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C43H45N3O5S/c44-38-14-6-7-15-39(38)46-42(49)17-9-8-16-41(48)45-27-34-10-4-5-13-37(34)31-22-24-33(25-23-31)43-50-35(29-52-36-11-2-1-3-12-36)26-40(51-43)32-20-18-30(28-47)19-21-32/h1-7,10-15,18-25,35,40,43,47H,8-9,16-17,26-29,44H2,(H,45,48)(H,46,49)/t35-,40+,43+/m1/s1 |
| InChIKey | NXLKCIPQTXMWLS-PGSJWCLOSA-N |
| XLogP | 8.58 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.92 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|