C47H52N4O6S — CID 5015108
N-[[2-[4-[4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-(2-aminophenyl)octanediamide (PubChem CID 5015108) has the molecular formula C47H52N4O6S and a molecular weight of 801.02 g/mol. Its IUPAC name is N-[[2-[4-[4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-(2-aminophenyl)octanediamide.
| Compound Name | N-[[2-[4-[4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-(2-aminophenyl)octanediamide |
|---|---|
| PubChem CID | 5015108 |
| Molecular Formula | C47H52N4O6S |
| Molecular Weight | 801.02 g/mol |
| Exact Mass | 800.36 |
| IUPAC Name | N-[[2-[4-[4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-N'-(2-aminophenyl)octanediamide |
| SMILES | CC(=O)Nc1ccc(SCC2CC(c3ccc(CO)cc3)OC(c3ccc(-c4ccccc4CNC(=O)CCCCCCC(=O)Nc4ccccc4N)cc3)O2)cc1 |
| InChI | InChI=1S/C47H52N4O6S/c1-32(53)50-38-24-26-40(27-25-38)58-31-39-28-44(35-18-16-33(30-52)17-19-35)57-47(56-39)36-22-20-34(21-23-36)41-11-7-6-10-37(41)29-49-45(54)14-4-2-3-5-15-46(55)51-43-13-9-8-12-42(43)48/h6-13,16-27,39,44,47,52H,2-5,14-15,28-31,48H2,1H3,(H,49,54)(H,50,53)(H,51,55) |
| InChIKey | YDGKKSQXFGCXSN-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.02 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|