C40H44N6O5S — CID 6672670
N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide (PubChem CID 6672670) has the molecular formula C40H44N6O5S and a molecular weight of 720.90 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
|---|---|
| PubChem CID | 6672670 |
| Molecular Formula | C40H44N6O5S |
| Molecular Weight | 720.90 g/mol |
| Exact Mass | 720.31 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CSc3ncn[nH]3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C40H44N6O5S/c41-34-10-6-7-11-35(34)45-38(49)13-3-1-2-12-37(48)42-23-31-8-4-5-9-33(31)28-18-20-30(21-19-28)39-50-32(25-52-40-43-26-44-46-40)22-36(51-39)29-16-14-27(24-47)15-17-29/h4-11,14-21,26,32,36,39,47H,1-3,12-13,22-25,41H2,(H,42,48)(H,45,49)(H,43,44,46)/t32-,36+,39+/m1/s1 |
| InChIKey | SPXVZRWWVHUGHS-BZKIRENISA-N |
| XLogP | 7.09 |
| TPSA | 164.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.90 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|