C38H40N6O5S — CID 6676264
N'-(2-aminophenyl)-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide (PubChem CID 6676264) has the molecular formula C38H40N6O5S and a molecular weight of 692.84 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 6676264 |
| Molecular Formula | C38H40N6O5S |
| Molecular Weight | 692.84 g/mol |
| Exact Mass | 692.28 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pentanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCC(=O)NCc1ccccc1-c1ccc([C@@H]2O[C@H](CSc3ncn[nH]3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C38H40N6O5S/c39-32-8-3-4-9-33(32)43-36(47)11-5-10-35(46)40-21-29-6-1-2-7-31(29)26-16-18-28(19-17-26)37-48-30(23-50-38-41-24-42-44-38)20-34(49-37)27-14-12-25(22-45)13-15-27/h1-4,6-9,12-19,24,30,34,37,45H,5,10-11,20-23,39H2,(H,40,46)(H,43,47)(H,41,42,44)/t30-,34+,37+/m0/s1 |
| InChIKey | JXPMLGYVYLYDED-XSFZZWOTSA-N |
| XLogP | 6.31 |
| TPSA | 164.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.84 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|