C32H36N6O5S — CID 6672631
N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6672631) has the molecular formula C32H36N6O5S and a molecular weight of 616.74 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6672631 |
| Molecular Formula | C32H36N6O5S |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)Nc1ccc([C@H]2O[C@@H](CSc3ncn[nH]3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C32H36N6O5S/c33-26-5-1-2-6-27(26)37-30(41)8-4-3-7-29(40)36-24-15-13-23(14-16-24)31-42-25(19-44-32-34-20-35-38-32)17-28(43-31)22-11-9-21(18-39)10-12-22/h1-2,5-6,9-16,20,25,28,31,39H,3-4,7-8,17-19,33H2,(H,36,40)(H,37,41)(H,34,35,38)/t25-,28+,31+/m1/s1 |
| InChIKey | GNJOCBKHEDHMKS-VUAYVDPTSA-N |
| XLogP | 5.35 |
| TPSA | 164.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|