C28H35N5O5S — CID 3250710
6-acetamido-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide (PubChem CID 3250710) has the molecular formula C28H35N5O5S and a molecular weight of 553.69 g/mol. Its IUPAC name is 6-acetamido-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide.
| Compound Name | 6-acetamido-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 3250710 |
| Molecular Formula | C28H35N5O5S |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 6-acetamido-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)Nc1ccc(C2OC(CSc3ncn[nH]3)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C28H35N5O5S/c1-19(35)29-14-4-2-3-5-26(36)32-23-12-10-22(11-13-23)27-37-24(17-39-28-30-18-31-33-28)15-25(38-27)21-8-6-20(16-34)7-9-21/h6-13,18,24-25,27,34H,2-5,14-17H2,1H3,(H,29,35)(H,32,36)(H,30,31,33) |
| InChIKey | WKEXPQXHVXQLOX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|