C29H36N4O6S — CID 6676247
8-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid (PubChem CID 6676247) has the molecular formula C29H36N4O6S and a molecular weight of 568.70 g/mol. Its IUPAC name is 8-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid.
| Compound Name | 8-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6676247 |
| Molecular Formula | C29H36N4O6S |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 8-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)NCc1ccc([C@@H]2O[C@H](CSc3ncn[nH]3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C29H36N4O6S/c34-17-21-9-11-22(12-10-21)25-15-24(18-40-29-31-19-32-33-29)38-28(39-25)23-13-7-20(8-14-23)16-30-26(35)5-3-1-2-4-6-27(36)37/h7-14,19,24-25,28,34H,1-6,15-18H2,(H,30,35)(H,36,37)(H,31,32,33)/t24-,25+,28+/m0/s1 |
| InChIKey | KLIUPSMVCKMBPK-BXTSTYNKSA-N |
| XLogP | 4.68 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|