C32H34N4O6S — CID 6672650
5-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 6672650) has the molecular formula C32H34N4O6S and a molecular weight of 602.71 g/mol. Its IUPAC name is 5-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6672650 |
| Molecular Formula | C32H34N4O6S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 5-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCc1cccc(-c2ccc([C@H]3O[C@@H](CSc4ncn[nH]4)C[C@@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C32H34N4O6S/c37-18-21-7-9-24(10-8-21)28-16-27(19-43-32-34-20-35-36-32)41-31(42-28)25-13-11-23(12-14-25)26-4-1-3-22(15-26)17-33-29(38)5-2-6-30(39)40/h1,3-4,7-15,20,27-28,31,37H,2,5-6,16-19H2,(H,33,38)(H,39,40)(H,34,35,36)/t27-,28+,31+/m1/s1 |
| InChIKey | BOCMXYOFKLKYSK-XHWIWGEHSA-N |
| XLogP | 5.17 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |