C31H32N4O5S — CID 6699104
prop-2-enyl N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate (PubChem CID 6699104) has the molecular formula C31H32N4O5S and a molecular weight of 572.69 g/mol. Its IUPAC name is prop-2-enyl N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 6699104 |
| Molecular Formula | C31H32N4O5S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | prop-2-enyl N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1cccc(-c2ccc([C@H]3O[C@@H](CSc4ncn[nH]4)C[C@@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C31H32N4O5S/c1-2-14-38-31(37)32-17-22-4-3-5-26(15-22)23-10-12-25(13-11-23)29-39-27(19-41-30-33-20-34-35-30)16-28(40-29)24-8-6-21(18-36)7-9-24/h2-13,15,20,27-29,36H,1,14,16-19H2,(H,32,37)(H,33,34,35)/t27-,28+,29+/m1/s1 |
| InChIKey | JRDJGPYABJQEBQ-ULNSLHSMSA-N |
| XLogP | 5.71 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|