C27H28N4O3S — CID 6699147
[4-[(2R,4S,6R)-2-[3-[3-(aminomethyl)phenyl]phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6699147) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is [4-[(2R,4S,6R)-2-[3-[3-(aminomethyl)phenyl]phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2R,4S,6R)-2-[3-[3-(aminomethyl)phenyl]phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6699147 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [4-[(2R,4S,6R)-2-[3-[3-(aminomethyl)phenyl]phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | NCc1cccc(-c2cccc([C@H]3O[C@@H](CSc4ncn[nH]4)C[C@@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C27H28N4O3S/c28-14-19-3-1-4-21(11-19)22-5-2-6-23(12-22)26-33-24(16-35-27-29-17-30-31-27)13-25(34-26)20-9-7-18(15-32)8-10-20/h1-12,17,24-26,32H,13-16,28H2,(H,29,30,31)/t24-,25+,26+/m1/s1 |
| InChIKey | WLIABYOGCJDTQD-ZNZIZOMTSA-N |
| XLogP | 4.76 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |