C24H26N4O6S — CID 6699071
4-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid (PubChem CID 6699071) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is 4-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6699071 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 4-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1cccc([C@H]2O[C@@H](CSc3ncn[nH]3)C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C24H26N4O6S/c29-12-15-4-6-16(7-5-15)20-11-19(13-35-24-25-14-26-28-24)33-23(34-20)17-2-1-3-18(10-17)27-21(30)8-9-22(31)32/h1-7,10,14,19-20,23,29H,8-9,11-13H2,(H,27,30)(H,31,32)(H,25,26,28)/t19-,20+,23+/m1/s1 |
| InChIKey | GGQAFJJLLMPYQX-QTEQDKRBSA-N |
| XLogP | 3.44 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |